* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-ILE-VAL-OH |
CAS: | 41487-00-7 |
English Synonyms: | Z-ILE-VAL-OH ; Z-L-ISOLEUCYL-L-VALINE |
MDL Number.: | MFCD00056157 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC[C@H](C)[C@@H](C(=O)N[C@@H](C(C)C)C(=O)O)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C19H28N2O5/c1-5-13(4)16(17(22)20-15(12(2)3)18(23)24)21-19(25)26-11-14-9-7-6-8-10-14/h6-10,12-13,15-16H,5,11H2,1-4H3,(H,20,22)(H,21,25)(H,23,24)/t13-,15-,16-/m0/s1 |
InChiKey: | InChIKey=XISNUVNLGJKNIK-BPUTZDHNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.