* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,4-DIMETHYL-1,4-PENTADIENE |
| CAS: | 4161-65-3 |
| English Synonyms: | 2,4-DIMETHYLPENTA-1,4-DIENE ; 2,4-DIMETHYL-1,4-PENTADIENE |
| MDL Number.: | MFCD00060910 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CC(=C)CC(=C)C |
| InChi: | InChI=1S/C7H12/c1-6(2)5-7(3)4/h1,3,5H2,2,4H3 |
| InChiKey: | InChIKey=ANKJYUSZUBOYDV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.