* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHORBOL-13,20-DIACETATE |
| CAS: | 41621-85-6 |
| English Synonyms: | PHORBOL-13,20-DIACETATE |
| MDL Number.: | MFCD00038366 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | C[C@@H]1[C@H]([C@@]2([C@@H](C2(C)C)[C@H]3[C@]1([C@@H]4C=C(C(=O)[C@]4(CC(=C3)COC(=O)C)O)C)O)OC(=O)C)O |
| InChi: | InChI=1S/C24H32O8/c1-11-7-17-22(29,19(11)27)9-15(10-31-13(3)25)8-16-18-21(5,6)24(18,32-14(4)26)20(28)12(2)23(16,17)30/h7-8,12,16-18,20,28-30H,9-10H2,1-6H3/t12-,16+,17-,18-,20-,22-,23-,24-/m1/s1 |
| InChiKey: | InChIKey=VCQRVYCLJARKLE-XQOWHXTBSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.