* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-CHLORO-5-(5-NITRO-2-FURYL)-S-TRIAZOLE |
CAS: | 41735-54-0 |
English Synonyms: | 3-CHLORO-5-(5-NITRO-2-FURYL)-S-TRIAZOLE ; 3-CHLORO-5-(5-NITROFURAN-2-YL)-4H-1,2,4-TRIAZOLE |
MDL Number.: | MFCD01750664 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | c1cc(oc1c2[nH]c(nn2)Cl)[N+](=O)[O-] |
InChi: | InChI=1S/C6H3ClN4O3/c7-6-8-5(9-10-6)3-1-2-4(14-3)11(12)13/h1-2H,(H,8,9,10) |
InChiKey: | InChIKey=OSDQSYYCUATBDU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.