* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VALENERAL |
CAS: | 4176-16-3 |
English Synonyms: | VALENERAL ; VALERENAL |
MDL Number.: | MFCD00075885 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C[C@@H]1CC[C@H](C2=C(CC[C@H]12)C)/C=C(\C)/C=O |
InChi: | InChI=1S/C15H22O/c1-10(9-16)8-13-6-4-11(2)14-7-5-12(3)15(13)14/h8-9,11,13-14H,4-7H2,1-3H3/b10-8+/t11-,13+,14-/m1/s1 |
InChiKey: | InChIKey=RJZWGDPBGWGJNU-MTXIQXFFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.