* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,1'-([1,1':4',1''-Terphenyl]-4,4''-diyl)diethanone |
CAS: | 4191-07-5 |
English Synonyms: | 1,1'-([1,1':4',1''-TERPHENYL]-4,4''-DIYL)DIETHANONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=C(C=C1)C(C)=O)C1=CC=C(C=C1)C1=CC=C(C=C1)C(C)=O |
InChi: | InChI=1S/C22H18O2/c1-15(23)17-3-7-19(8-4-17)21-11-13-22(14-12-21)20-9-5-18(6-10-20)16(2)24/h3-14H,1-2H3 |
InChiKey: | InChIKey=LSRWKYYPPBDFRR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.