* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4,4'-(PENTANE-2,2-DIYL)DIPHENOL |
| CAS: | 4204-58-4 |
| English Synonyms: | 4,4'-(PENTANE-2,2-DIYL)DIPHENOL |
| MDL Number.: | MFCD16876272 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CCCC(C)(c1ccc(cc1)O)c2ccc(cc2)O |
| InChi: | InChI=1S/C17H20O2/c1-3-12-17(2,13-4-8-15(18)9-5-13)14-6-10-16(19)11-7-14/h4-11,18-19H,3,12H2,1-2H3 |
| InChiKey: | InChIKey=WCUDAIJOADOKAW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.