* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FEMA 2869 |
CAS: | 42078-65-9 |
English Synonyms: | FEMA 2869 ; PHENYLETHYL-SENECIOATE |
MDL Number.: | MFCD00672755 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(=CC(=O)OCCc1ccccc1)C |
InChi: | InChI=1S/C13H16O2/c1-11(2)10-13(14)15-9-8-12-6-4-3-5-7-12/h3-7,10H,8-9H2,1-2H3 |
InChiKey: | InChIKey=QTCRFFUEUAXZNW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.