* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ACYLATE |
CAS: | 4212-94-6 |
English Synonyms: | ACYLATE |
MDL Number.: | MFCD01739038 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(C)OC(=O)N(c1ccccc1)OC(=O)C |
InChi: | InChI=1S/C12H15NO4/c1-9(2)16-12(15)13(17-10(3)14)11-7-5-4-6-8-11/h4-9H,1-3H3 |
InChiKey: | InChIKey=ODIGIKRIUKFKHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.