* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,4-DICHLORO-3-BUTEN-1-OL |
CAS: | 42134-33-8 |
English Synonyms: | 4,4-DICHLOROBUT-3-EN-1-OL ; 4,4-DICHLORO-3-BUTEN-1-OL |
MDL Number.: | MFCD17013378 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C(CO)C=C(Cl)Cl |
InChi: | InChI=1S/C4H6Cl2O/c5-4(6)2-1-3-7/h2,7H,1,3H2 |
InChiKey: | InChIKey=SWKSVRXPMSGZLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.