* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ACETYL-9H-FLUOREN-9-ONE |
CAS: | 42136-05-0 |
English Synonyms: | 2-ACETYL-9H-FLUOREN-9-ONE ; 9H-FLUOREN-9-ONE, 2-ACETYL- |
MDL Number.: | MFCD00445272 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(=O)c1ccc-2c(c1)C(=O)c3c2cccc3 |
InChi: | InChI=1S/C15H10O2/c1-9(16)10-6-7-12-11-4-2-3-5-13(11)15(17)14(12)8-10/h2-8H,1H3 |
InChiKey: | InChIKey=CWXNCOWTIATRLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.