* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-CHLORO-3-PHENYLDIAZIRINE |
| CAS: | 4460-46-2 ;4222-25-7 |
| English Synonyms: | 3-CHLORO-3-PHENYLDIAZIRINE |
| MDL Number.: | MFCD17013499 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)C2(N=N2)Cl |
| InChi: | InChI=1S/C7H5ClN2/c8-7(9-10-7)6-4-2-1-3-5-6/h1-5H |
| InChiKey: | InChIKey=VWAYXULOLUTAHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.