* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-LEU-ILE-OH |
CAS: | 42537-96-2 |
English Synonyms: | Z-LEU-ILE-OH |
MDL Number.: | MFCD00027067 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C20H30N2O5/c1-5-14(4)17(19(24)25)22-18(23)16(11-13(2)3)21-20(26)27-12-15-9-7-6-8-10-15/h6-10,13-14,16-17H,5,11-12H2,1-4H3,(H,21,26)(H,22,23)(H,24,25)/t14-,16-,17-/m0/s1 |
InChiKey: | InChIKey=VFBACQGDAHTASH-XIRDDKMYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.