* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3-EPOXYAFLATOXIN B1 |
CAS: | 42583-46-0 |
English Synonyms: | 2,3-EPOXYAFLATOXIN B1 |
MDL Number.: | MFCD00210736 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | COc1cc2c(c3c1c4c(c(=O)o3)C(=O)CC4)[C@H]5C6C(O6)O[C@H]5O2 |
InChi: | InChI=1S/C17H12O7/c1-20-7-4-8-11(12-14-17(23-14)24-16(12)21-8)13-10(7)5-2-3-6(18)9(5)15(19)22-13/h4,12,14,16-17H,2-3H2,1H3/t12-,14?,16+,17?/m0/s1 |
InChiKey: | InChIKey=KHBXRZGALJGBPA-DUFSDNGMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.