* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-BENZYLAMINOPURINE-8-14C |
| CAS: | 4261-06-7 |
| English Synonyms: | 6-BENZYLAMINOPURINE-8-14C ; N6-BENZYLADENINE, [8-14C]- |
| MDL Number.: | MFCD00133003 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)CNc2c3c([nH][14cH]n3)ncn2 |
| InChi: | InChI=1S/C12H11N5/c1-2-4-9(5-3-1)6-13-11-10-12(15-7-14-10)17-8-16-11/h1-5,7-8H,6H2,(H2,13,14,15,16,17)/i7+2 |
| InChiKey: | InChIKey=NWBJYWHLCVSVIJ-WGGUOBTBSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.