* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-[1,2,4]TRIAZOLO[4,3-A]BENZIMIDAZOLE-3-THIOL |
CAS: | 4290-98-6 |
English Synonyms: | 9H-[1,2,4]TRIAZOLO[4,3-A]BENZIMIDAZOLE-3-THIOL |
MDL Number.: | MFCD01103518 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)[nH]c3n2c(nn3)S |
InChi: | InChI=1S/C8H6N4S/c13-8-11-10-7-9-5-3-1-2-4-6(5)12(7)8/h1-4H,(H,9,10)(H,11,13) |
InChiKey: | InChIKey=BJNKXZQNKYMVMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.