* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HEPTYLUREA |
| CAS: | 42955-46-4 |
| English Synonyms: | HEPTYLUREA ; N-HEPTYLUREA |
| MDL Number.: | MFCD00025459 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCCCCCNC(=O)N |
| InChi: | InChI=1S/C8H18N2O/c1-2-3-4-5-6-7-10-8(9)11/h2-7H2,1H3,(H3,9,10,11) |
| InChiKey: | InChIKey=LDNJCDRFTFLQLF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.