* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-METHOXY-3-BUTEN-2-ONE |
CAS: | 43042-58-6 |
English Synonyms: | 1-METHOXY-3-BUTEN-2-ONE ; 1-METHOXYBUT-3-EN-2-ONE |
MDL Number.: | MFCD17013427 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | COCC(=O)C=C |
InChi: | InChI=1S/C5H8O2/c1-3-5(6)4-7-2/h3H,1,4H2,2H3 |
InChiKey: | InChIKey=QTDSKVOHJOFQES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.