* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Cyclopropanol, 1-(3-chlorophenyl)- |
CAS: | 43187-67-3 |
English Synonyms: | CYCLOPROPANOL, 1-(3-CHLOROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC=1C=C(C=CC1)C1(CC1)O |
InChi: | InChI=1S/C9H9ClO/c10-8-3-1-2-7(6-8)9(11)4-5-9/h1-3,6,11H,4-5H2 |
InChiKey: | InChIKey=KKKBEWZDUVBFTM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.