* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-IODO-5-METHOXYPYRIDIN-2-OL |
CAS: | 431942-24-4 |
English Synonyms: | 3-IODO-5-METHOXYPYRIDIN-2-OL |
MDL Number.: | MFCD17012762 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COc1cc(c(nc1)O)I |
InChi: | InChI=1S/C6H6INO2/c1-10-4-2-5(7)6(9)8-3-4/h2-3H,1H3,(H,8,9) |
InChiKey: | InChIKey=VLYHNSOFCFTUFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.