* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ACETYL COENZYME A, [ACETYL-1-14C] |
CAS: | 4332-37-0 |
English Synonyms: | ACETYL COENZYME A, [ACETYL-1-14C] |
MDL Number.: | MFCD00189473 |
H bond acceptor: | 24 |
H bond donor: | 9 |
Smile: | C[14C](=O)SCCNC(=O)CCNC(=O)[C@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)O |
InChi: | InChI=1S/C23H38N7O17P3S/c1-12(31)51-7-6-25-14(32)4-5-26-21(35)18(34)23(2,3)9-44-50(41,42)47-49(39,40)43-8-13-17(46-48(36,37)38)16(33)22(45-13)30-11-29-15-19(24)27-10-28-20(15)30/h10-11,13,16-18,22,33-34H,4-9H2,1-3H3,(H,25,32)(H,26,35)(H,39,40)(H,41,42)(H2,24,27,28)(H2,36,37,38)/t13-,16-,17-,18-,22-/m1/s1/i12+2 |
InChiKey: | InChIKey=ZSLZBFCDCINBPY-RRDSQDKDSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.