* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,6-PIPERAZINEDIONE, 3-METHYL-, (3R)- |
| CAS: | 434314-23-5 |
| English Synonyms: | 2,6-PIPERAZINEDIONE, 3-METHYL-, (3R)- |
| MDL Number.: | MFCD18831646 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C[C@@H]1C(=O)NC(=O)CN1 |
| InChi: | InChI=1S/C5H8N2O2/c1-3-5(9)7-4(8)2-6-3/h3,6H,2H2,1H3,(H,7,8,9)/t3-/m1/s1 |
| InChiKey: | InChIKey=XNJHLZCLSPEUJN-GSVOUGTGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.