* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,5-DIMETHYL-4-PHENYL-1H-PYRAZOLE |
CAS: | 4345-49-7 |
English Synonyms: | 3,5-DIMETHYL-4-PHENYL-1H-PYRAZOLE |
MDL Number.: | MFCD00159662 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1c(c(n[nH]1)C)c2ccccc2 |
InChi: | InChI=1S/C11H12N2/c1-8-11(9(2)13-12-8)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,12,13) |
InChiKey: | InChIKey=ZKTZVPARPDWOAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.