* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-CYCLOHEXYL-2-PROPEN-1-OL |
CAS: | 4352-44-7 |
English Synonyms: | 1-CYCLOHEXYLPROP-2-EN-1-OL ; 1-CYCLOHEXYL-2-PROPEN-1-OL |
MDL Number.: | MFCD00060818 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C=CC(C1CCCCC1)O |
InChi: | InChI=1S/C9H16O/c1-2-9(10)8-6-4-3-5-7-8/h2,8-10H,1,3-7H2 |
InChiKey: | InChIKey=BRZYZVXYQQVYNT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.