* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(5-AMINO-1H-BENZOIMIDAZOL-2-YL)-PHENOL |
CAS: | 436100-00-4 |
English Synonyms: | 3-(5-AMINO-1H-BENZOIMIDAZOL-2-YL)-PHENOL |
MDL Number.: | MFCD00441575 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | c1cc(cc(c1)O)c2[nH]c3ccc(cc3n2)N |
InChi: | InChI=1S/C13H11N3O/c14-9-4-5-11-12(7-9)16-13(15-11)8-2-1-3-10(17)6-8/h1-7,17H,14H2,(H,15,16) |
InChiKey: | InChIKey=ULADCLDYBHCFNQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.