* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-IODOPROPENE |
CAS: | 4375-96-6 |
English Synonyms: | 2-IODOPROP-1-ENE ; 2-IODOPROPENE |
MDL Number.: | MFCD00040004 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(=C)I |
InChi: | InChI=1S/C3H5I/c1-3(2)4/h1H2,2H3 |
InChiKey: | InChIKey=KWAHADSKPFGJQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.