* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(2,3,4-TRIFLUORO-PHENYL)-1H-IMIDAZOLE |
| CAS: | 438554-18-8 |
| English Synonyms: | 2-(2,3,4-TRIFLUORO-PHENYL)-1H-IMIDAZOLE |
| MDL Number.: | MFCD08668971 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc(c(c(c1c2[nH]ccn2)F)F)F |
| InChi: | InChI=1S/C9H5F3N2/c10-6-2-1-5(7(11)8(6)12)9-13-3-4-14-9/h1-4H,(H,13,14) |
| InChiKey: | InChIKey=FSMNQUNKDQSSJO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.