* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2',2''-(1,3,5-TRIAZINE-2,4,6-TRIYLTRIIMINO)TRISETHANOL |
CAS: | 4403-07-0 |
English Synonyms: | 2,2',2''-(1,3,5-TRIAZINE-2,4,6-TRIYLTRIIMINO)TRISETHANOL |
MDL Number.: | MFCD00082204 |
H bond acceptor: | 9 |
H bond donor: | 6 |
Smile: | C(CO)Nc1nc(nc(n1)NCCO)NCCO |
InChi: | InChI=1S/C9H18N6O3/c16-4-1-10-7-13-8(11-2-5-17)15-9(14-7)12-3-6-18/h16-18H,1-6H2,(H3,10,11,12,13,14,15) |
InChiKey: | InChIKey=MNGSQDSFUODZAR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.