* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TESTOLOLACTONE |
CAS: | 4416-57-3 |
English Synonyms: | TESTOLOLACTONE |
MDL Number.: | MFCD00198952 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC(=O)O4)C |
InChi: | InChI=1S/C19H26O3/c1-18-9-7-13(20)11-12(18)3-4-14-15(18)8-10-19(2)16(14)5-6-17(21)22-19/h11,14-16H,3-10H2,1-2H3/t14-,15+,16+,18+,19+/m1/s1 |
InChiKey: | InChIKey=CNIXJDVUMXTEKX-DZBHQSCQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.