* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2-DIAMINOBUTANE |
CAS: | 4426-48-6 |
English Synonyms: | 1,2-DIAMINOBUTANE ; BUTANE-1,2-DIAMINE |
MDL Number.: | MFCD00082190 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CCC(CN)N |
InChi: | InChI=1S/C4H12N2/c1-2-4(6)3-5/h4H,2-3,5-6H2,1H3 |
InChiKey: | InChIKey=ULEAQRIQMIQDPJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.