* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(3-THIENYL)-3H-THIENO[3,2-D]PYRIMID-4-ONE |
CAS: | 443762-10-5 |
English Synonyms: | 6-(3-THIENYL)-3H-THIENO[3,2-D]PYRIMID-4-ONE |
MDL Number.: | MFCD17214221 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c2c(c(=O)[nH]cn2)sc1C3C=CS=C3 |
InChi: | InChI=1S/C10H7N2OS2/c13-10-9-7(11-5-12-10)3-8(15-9)6-1-2-14-4-6/h1-6H,(H,11,12,13) |
InChiKey: | InChIKey=QKHFHNCGTQTSFR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.