* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PERSILIC ACID |
| CAS: | 4444-23-9 |
| English Synonyms: | PERSILIC ACID |
| MDL Number.: | MFCD00243075 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1c(c(cc(c1S(=O)(=O)O)O)S(=O)(=O)O)O |
| InChi: | InChI=1S/C6H6O8S2/c7-3-1-5(15(9,10)11)4(8)2-6(3)16(12,13)14/h1-2,7-8H,(H,9,10,11)(H,12,13,14) |
| InChiKey: | InChIKey=VSAZFRKEFQPOIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.