* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GENISTEINE |
CAS: | 446-95-7 |
English Synonyms: | 11-ISOSPARTEINE ; GENISTEINE |
MDL Number.: | MFCD00135841 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CCN2C[C@@H]3C[C@H]([C@H]2C1)CN4[C@@H]3CCCC4 |
InChi: | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14+,15+/m0/s1 |
InChiKey: | InChIKey=SLRCCWJSBJZJBV-BYNSBNAKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.