* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYROXASULFONE |
CAS: | 447399-55-5 |
English Synonyms: | PYROXASULFONE |
MDL Number.: | MFCD17167020 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CC1(CC(=NO1)S(=O)(=O)Cc2c(nn(c2OC(F)F)C)C(F)(F)F)C |
InChi: | InChI=1S/C12H14F5N3O4S/c1-11(2)4-7(19-24-11)25(21,22)5-6-8(12(15,16)17)18-20(3)9(6)23-10(13)14/h10H,4-5H2,1-3H3 |
InChiKey: | InChIKey=CASLETQIYIQFTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.