* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-HYDROXYHEXANOIC ACID |
| CAS: | 83972-61-6 ;185956-02-9 ;44843-89-2 |
| English Synonyms: | 5-HYDROXYHEXANOIC ACID |
| MDL Number.: | MFCD07346329 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC(CCCC(=O)O)O |
| InChi: | InChI=1S/C6H12O3/c1-5(7)3-2-4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9) |
| InChiKey: | InChIKey=YDCRNMJQROAWFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.