* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-ALA-D-GLU-NH2 |
| CAS: | 45159-25-9 |
| English Synonyms: | H-ALA-D-GLU-NH2 ; L-ALA-D-ISOGLN ; H-ALA-D-ISOGLN-OH |
| MDL Number.: | MFCD00237727 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | C[C@@H](C(=O)N[C@H](CCC(=O)O)C(=O)N)N |
| InChi: | InChI=1S/C8H15N3O4/c1-4(9)8(15)11-5(7(10)14)2-3-6(12)13/h4-5H,2-3,9H2,1H3,(H2,10,14)(H,11,15)(H,12,13)/t4-,5+/m0/s1 |
| InChiKey: | InChIKey=NKUHWWPUOXOIIR-CRCLSJGQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.