Molecular Structure:
CAS No.:
286367-79-1
;45498-20-2
Product Name.:
CCD No.:CCD00191947
Formula:C5 D6 N2
MolWeight:100.153
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 4-AMINOPYRIDINE-D6 |
| CAS： | 286367-79-1 ;45498-20-2 |
| English Synonyms： | 4-AMINOPYRIDINE-D6 |
| MDL Number.： | MFCD01074266 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | [2H]c1c(nc(c(c1N([2H])[2H])[2H])[2H])[2H] |
| InChiKey： | InChIKey=null |
|
|
| Melting Point： | 155-158 DEG C(LIT) |
| Boiling Point： | 273 DEG C(LIT) |
| Comments： | MASS SHIFT: M+6 RIDADR: UN 2671 6.1/PG 2 WGK: 3 |
| Information： | ISOTOPIC PURITY: 98 ATOM % D MW: 100.03 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
