* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ACETYL BROMIDE, [1-14C] |
CAS: | 4561-20-0 |
English Synonyms: | ACETYL BROMIDE, [1-14C] |
MDL Number.: | MFCD00189468 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C[14C](=O)Br |
InChi: | InChI=1S/C2H3BrO/c1-2(3)4/h1H3/i2+2 |
InChiKey: | InChIKey=FXXACINHVKSMDR-HQMMCQRPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.