* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-BROMO-5-FLUORO-2H-CHROMENE |
CAS: | 457628-52-3 |
English Synonyms: | 8-BROMO-5-FLUORO-2H-CHROMENE |
MDL Number.: | MFCD16876861 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc(c2c(c1F)C=CCO2)Br |
InChi: | InChI=1S/C9H6BrFO/c10-7-3-4-8(11)6-2-1-5-12-9(6)7/h1-4H,5H2 |
InChiKey: | InChIKey=QMKXIHSGSUGVEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.