* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3,4,5-TETRAHYDRO-1,2,4-TRIAZINE-3,5-DITHIONE |
CAS: | 461-90-5 |
English Synonyms: | 2H,4H-1,2,4-TRIAZINE-3,5-DITHIONE ; 2,3,4,5-TETRAHYDRO-1,2,4-TRIAZINE-3,5-DITHIONE |
MDL Number.: | MFCD00522557 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1c(=S)[nH]c(=S)[nH]n1 |
InChi: | InChI=1S/C3H3N3S2/c7-2-1-4-6-3(8)5-2/h1H,(H2,5,6,7,8) |
InChiKey: | InChIKey=IIYCDUJGGHBHAQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.