* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2(1H)-PYRIDINONE, 4-METHYL-1-(2-PROPYNYL)- |
CAS: | 461661-59-6 |
English Synonyms: | 2(1H)-PYRIDINONE, 4-METHYL-1-(2-PROPYNYL)- ; 4-METHYL-1-(2-PROPYNYL)-2(1H)-PYRIDINONE |
MDL Number.: | MFCD17261159 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | Cc1ccn(c(=O)c1)CC#C |
InChi: | InChI=1S/C9H9NO/c1-3-5-10-6-4-8(2)7-9(10)11/h1,4,6-7H,5H2,2H3 |
InChiKey: | InChIKey=JCTTXMCXHOZSPB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.