* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JANUS GREEN |
CAS: | 4618-88-6 |
English Synonyms: | JANUS GREEN G ; JANUS GREEN |
MDL Number.: | MFCD01941509 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CN(C)c1ccc(cc1)/N=N/c2ccc3c(c2)[n+](c4cc(ccc4n3)N)c5ccccc5.[Cl-] |
InChi: | InChI=1S/C26H22N6.ClH/c1-31(2)21-12-9-19(10-13-21)29-30-20-11-15-24-26(17-20)32(22-6-4-3-5-7-22)25-16-18(27)8-14-23(25)28-24;/h3-17,27H,1-2H3;1H/b30-29+; |
InChiKey: | InChIKey=VZCCTDLWCKUBGD-BXGDTPBJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.