* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUADROSILAN |
| CAS: | 4657-20-9 ;33204-76-1 |
| English Synonyms: | QUADROSILAN |
| MDL Number.: | MFCD00868586 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | C[Si]1(O[Si](O[Si](O[Si](O1)(C)c2ccccc2)(C)C)(C)c3ccccc3)C |
| InChi: | InChI=1S/C18H28O4Si4/c1-23(2)19-25(5,17-13-9-7-10-14-17)21-24(3,4)22-26(6,20-23)18-15-11-8-12-16-18/h7-16H,1-6H3 |
| InChiKey: | InChIKey=ZTQZMPQJXABFNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.