* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | REHMANNIC ACID |
CAS: | 467-81-2 |
English Synonyms: | REHMANNIC ACID |
MDL Number.: | MFCD01710988 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C/C=C(/C)\C(=O)O[C@@H]1CC(C[C@@H]2[C@]1(CC[C@@]3(C2=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)C)C(=O)O)(C)C |
InChi: | InChI=1S/C35H52O5/c1-10-21(2)28(37)40-27-20-30(3,4)19-23-22-11-12-25-32(7)15-14-26(36)31(5,6)24(32)13-16-34(25,9)33(22,8)17-18-35(23,27)29(38)39/h10-11,23-25,27H,12-20H2,1-9H3,(H,38,39)/b21-10-/t23-,24-,25+,27+,32-,33+,34+,35-/m0/s1 |
InChiKey: | InChIKey=KCLIRHUTOPOHKJ-LSZVMECJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.