* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LANTADENE B |
| CAS: | 467-82-3 |
| English Synonyms: | LANTADENE B |
| MDL Number.: | MFCD01710989 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(=CC(=O)O[C@@H]1CC(C[C@@H]2[C@]1(CC[C@@]3(C2=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)C)C(=O)O)(C)C)C |
| InChi: | InChI=1S/C35H52O5/c1-21(2)18-28(37)40-27-20-30(3,4)19-23-22-10-11-25-32(7)14-13-26(36)31(5,6)24(32)12-15-34(25,9)33(22,8)16-17-35(23,27)29(38)39/h10,18,23-25,27H,11-17,19-20H2,1-9H3,(H,38,39)/t23-,24-,25+,27+,32-,33+,34+,35-/m0/s1 |
| InChiKey: | InChIKey=VYPAPFHUHDWCBI-QQAPFUPGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.