* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4,5-DIPHENYLOXAZOLE |
| CAS: | 4675-18-7 |
| English Synonyms: | 4,5-DIPHENYLOXAZOLE |
| MDL Number.: | MFCD16990157 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)c2c(ocn2)c3ccccc3 |
| InChi: | InChI=1S/C15H11NO/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H |
| InChiKey: | InChIKey=ODKHOKLXMBWVOQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.