* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GRAYANOTOXIN II |
CAS: | 4678-44-8 |
English Synonyms: | GRAYANOTOXIN II |
MDL Number.: | MFCD01714981 |
H bond acceptor: | 5 |
H bond donor: | 5 |
Smile: | CC1([C@H](C[C@@H]2[C@@]1([C@@H](C[C@@]34C[C@@]([C@@H]([C@H]3O)CC[C@H]4C2=C)(C)O)O)O)O)C |
InChi: | InChI=1S/C20H32O5/c1-10-11-5-6-12-16(23)19(11,9-18(12,4)24)8-15(22)20(25)13(10)7-14(21)17(20,2)3/h11-16,21-25H,1,5-9H2,2-4H3/t11-,12+,13-,14-,15+,16+,18+,19-,20-/m0/s1 |
InChiKey: | InChIKey=KEOQZUCOGXIEQR-LXFHFZRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.