* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PISATIN |
| CAS: | 20186-22-5 ;469-01-2 |
| English Synonyms: | (+)-PISATIN ; PISATIN |
| MDL Number.: | MFCD00075994 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COc1ccc2c(c1)OC[C@]3([C@@H]2Oc4c3cc5c(c4)OCO5)O |
| InChi: | InChI=1S/C17H14O6/c1-19-9-2-3-10-12(4-9)20-7-17(18)11-5-14-15(22-8-21-14)6-13(11)23-16(10)17/h2-6,16,18H,7-8H2,1H3/t16-,17+/m1/s1 |
| InChiKey: | InChIKey=LZMRDTLRSDRUSU-SJORKVTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.