* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 18BETA(H)-OLEANANE |
CAS: | 471-67-0 |
English Synonyms: | 18BETAO ; 18BETA(H)-OLEANANE |
MDL Number.: | MFCD00216327 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3([C@@H]([C@@H]2C1)CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCCC5(C)C)C)C)C)C)C |
InChi: | InChI=1S/C30H52/c1-25(2)16-17-27(5)18-19-29(7)21(22(27)20-25)10-11-24-28(6)14-9-13-26(3,4)23(28)12-15-30(24,29)8/h21-24H,9-20H2,1-8H3/t21-,22+,23+,24-,27-,28+,29-,30-/m1/s1 |
InChiKey: | InChIKey=VCNKUCWWHVTTBY-KQCVGMHHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.