* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,1':4',1''-Terphenyl, 4,4''-diethynyl- |
CAS: | 47230-46-6 |
English Synonyms: | 1,1':4',1''-TERPHENYL, 4,4''-DIETHYNYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(#C)C1=CC=C(C=C1)C1=CC=C(C=C1)C1=CC=C(C=C1)C#C |
InChi: | InChI=1S/C22H14/c1-3-17-5-9-19(10-6-17)21-13-15-22(16-14-21)20-11-7-18(4-2)8-12-20/h1-2,5-16H |
InChiKey: | InChIKey=GJFFMABLPMLHJW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.